C23H38N4O2 — CID 142242040
(2R)-2-(4-butyl-3-oxopiperazin-1-yl)-N-[3-[(3-ethylphenyl)methylamino]propyl]propanamide (PubChem CID 142242040) has the molecular formula C23H38N4O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is (2R)-2-(4-butyl-3-oxopiperazin-1-yl)-N-[3-[(3-ethylphenyl)methylamino]propyl]propanamide.
| Compound Name | (2R)-2-(4-butyl-3-oxopiperazin-1-yl)-N-[3-[(3-ethylphenyl)methylamino]propyl]propanamide |
|---|---|
| PubChem CID | 142242040 |
| Molecular Formula | C23H38N4O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | (2R)-2-(4-butyl-3-oxopiperazin-1-yl)-N-[3-[(3-ethylphenyl)methylamino]propyl]propanamide |
| SMILES | CCCCN1CCN([C@H](C)C(=O)NCCCNCc2cccc(CC)c2)CC1=O |
| InChI | InChI=1S/C23H38N4O2/c1-4-6-13-26-14-15-27(18-22(26)28)19(3)23(29)25-12-8-11-24-17-21-10-7-9-20(5-2)16-21/h7,9-10,16,19,24H,4-6,8,11-15,17-18H2,1-3H3,(H,25,29)/t19-/m1/s1 |
| InChIKey | AVRIRQHJBNUNIT-LJQANCHMSA-N |
| XLogP | 2.18 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|