C30H40F2N4O4 — CID 69025610
N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(2,3-dioxo-4-pentylpiperazin-1-yl)acetamide (PubChem CID 69025610) has the molecular formula C30H40F2N4O4 and a molecular weight of 558.67 g/mol. Its IUPAC name is N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(2,3-dioxo-4-pentylpiperazin-1-yl)acetamide.
| Compound Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(2,3-dioxo-4-pentylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 69025610 |
| Molecular Formula | C30H40F2N4O4 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-2-(2,3-dioxo-4-pentylpiperazin-1-yl)acetamide |
| SMILES | CCCCCN1CCN(CC(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@@H](O)CNCc2cccc(CC)c2)C(=O)C1=O |
| InChI | InChI=1S/C30H40F2N4O4/c1-3-5-6-10-35-11-12-36(30(40)29(35)39)20-28(38)34-26(16-23-14-24(31)17-25(32)15-23)27(37)19-33-18-22-9-7-8-21(4-2)13-22/h7-9,13-15,17,26-27,33,37H,3-6,10-12,16,18-20H2,1-2H3,(H,34,38)/t26-,27-/m0/s1 |
| InChIKey | AQOMFTROEFZAJP-SVBPBHIXSA-N |
| XLogP | 2.57 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|