C33H41F2N3O3 — CID 142673171
4-butyl-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3,5-dihydro-2H-1,4-benzoxazepine-6-carboxamide (PubChem CID 142673171) has the molecular formula C33H41F2N3O3 and a molecular weight of 565.71 g/mol. Its IUPAC name is 4-butyl-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3,5-dihydro-2H-1,4-benzoxazepine-6-carboxamide.
| Compound Name | 4-butyl-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3,5-dihydro-2H-1,4-benzoxazepine-6-carboxamide |
|---|---|
| PubChem CID | 142673171 |
| Molecular Formula | C33H41F2N3O3 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | 4-butyl-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3,5-dihydro-2H-1,4-benzoxazepine-6-carboxamide |
| SMILES | CCCCN1CCOc2cccc(C(=O)N[C@@H](Cc3cc(F)cc(F)c3)[C@H](O)CNCc3cccc(CC)c3)c2C1 |
| InChI | InChI=1S/C33H41F2N3O3/c1-3-5-12-38-13-14-41-32-11-7-10-28(29(32)22-38)33(40)37-30(18-25-16-26(34)19-27(35)17-25)31(39)21-36-20-24-9-6-8-23(4-2)15-24/h6-11,15-17,19,30-31,36,39H,3-5,12-14,18,20-22H2,1-2H3,(H,37,40)/t30-,31+/m0/s1 |
| InChIKey | YPWZSJLGBPJKLI-IOWSJCHKSA-N |
| XLogP | 5.01 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |