C26H33F2N5O2 — CID 68611478
N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-(1,2,4-triazol-1-yl)pentanamide (PubChem CID 68611478) has the molecular formula C26H33F2N5O2 and a molecular weight of 485.58 g/mol. Its IUPAC name is N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-(1,2,4-triazol-1-yl)pentanamide.
| Compound Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-(1,2,4-triazol-1-yl)pentanamide |
|---|---|
| PubChem CID | 68611478 |
| Molecular Formula | C26H33F2N5O2 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-5-(1,2,4-triazol-1-yl)pentanamide |
| SMILES | CCc1cccc(CNC[C@H](O)[C@H](Cc2cc(F)cc(F)c2)NC(=O)CCCCn2cncn2)c1 |
| InChI | InChI=1S/C26H33F2N5O2/c1-2-19-6-5-7-20(10-19)15-29-16-25(34)24(13-21-11-22(27)14-23(28)12-21)32-26(35)8-3-4-9-33-18-30-17-31-33/h5-7,10-12,14,17-18,24-25,29,34H,2-4,8-9,13,15-16H2,1H3,(H,32,35)/t24-,25-/m0/s1 |
| InChIKey | JAEGRGDYXPEZBR-DQEYMECFSA-N |
| XLogP | 3.17 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|