C29H32Cl2F2N2O3 — CID 57487625
4-(2,4-dichlorophenoxy)-N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]butanamide (PubChem CID 57487625) has the molecular formula C29H32Cl2F2N2O3 and a molecular weight of 565.49 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]butanamide |
|---|---|
| PubChem CID | 57487625 |
| Molecular Formula | C29H32Cl2F2N2O3 |
| Molecular Weight | 565.49 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[(2S,3S)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]butanamide |
| SMILES | CCc1cccc(CNC[C@H](O)[C@H](Cc2cc(F)cc(F)c2)NC(=O)CCCOc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C29H32Cl2F2N2O3/c1-2-19-5-3-6-20(11-19)17-34-18-27(36)26(14-21-12-23(32)16-24(33)13-21)35-29(37)7-4-10-38-28-9-8-22(30)15-25(28)31/h3,5-6,8-9,11-13,15-16,26-27,34,36H,2,4,7,10,14,17-18H2,1H3,(H,35,37)/t26-,27-/m0/s1 |
| InChIKey | OUFOHOXGMHSBBL-SVBPBHIXSA-N |
| XLogP | 5.87 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|