C26H34F2N2O3 — CID 142242094
5-amino-5-oxopentanoic acid;N-[4-(3,5-difluorophenyl)butyl]-1-(3-ethylphenyl)cyclopropan-1-amine (PubChem CID 142242094) has the molecular formula C26H34F2N2O3 and a molecular weight of 460.57 g/mol. Its IUPAC name is 5-amino-5-oxopentanoic acid;N-[4-(3,5-difluorophenyl)butyl]-1-(3-ethylphenyl)cyclopropan-1-amine.
| Compound Name | 5-amino-5-oxopentanoic acid;N-[4-(3,5-difluorophenyl)butyl]-1-(3-ethylphenyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 142242094 |
| Molecular Formula | C26H34F2N2O3 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 5-amino-5-oxopentanoic acid;N-[4-(3,5-difluorophenyl)butyl]-1-(3-ethylphenyl)cyclopropan-1-amine |
| SMILES | CCc1cccc(C2(NCCCCc3cc(F)cc(F)c3)CC2)c1.NC(=O)CCCC(=O)O |
| InChI | InChI=1S/C21H25F2N.C5H9NO3/c1-2-16-7-5-8-18(12-16)21(9-10-21)24-11-4-3-6-17-13-19(22)15-20(23)14-17;6-4(7)2-1-3-5(8)9/h5,7-8,12-15,24H,2-4,6,9-11H2,1H3;1-3H2,(H2,6,7)(H,8,9) |
| InChIKey | NKKFYMJCRIQXTJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|