C31H46FN3O3 — CID 142195234
N'-[4-[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]butyl]-N'-propylpentanediamide (PubChem CID 142195234) has the molecular formula C31H46FN3O3 and a molecular weight of 527.73 g/mol. Its IUPAC name is N'-[4-[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]butyl]-N'-propylpentanediamide.
| Compound Name | N'-[4-[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]butyl]-N'-propylpentanediamide |
|---|---|
| PubChem CID | 142195234 |
| Molecular Formula | C31H46FN3O3 |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.35 |
| IUPAC Name | N'-[4-[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]butyl]-N'-propylpentanediamide |
| SMILES | CCCN(CCCCOc1cc(F)cc(CCCCNCc2cccc(CC)c2)c1)C(=O)CCCC(N)=O |
| InChI | InChI=1S/C31H46FN3O3/c1-3-17-35(31(37)15-10-14-30(33)36)18-7-8-19-38-29-22-26(21-28(32)23-29)11-5-6-16-34-24-27-13-9-12-25(4-2)20-27/h9,12-13,20-23,34H,3-8,10-11,14-19,24H2,1-2H3,(H2,33,36) |
| InChIKey | OBQLMJQPOQEUCZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|