C37H47FN4O3 — CID 142195250
3-[[4-[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]butyl-propylamino]methyl]-5-(1,3-oxazol-2-yl)benzamide (PubChem CID 142195250) has the molecular formula C37H47FN4O3 and a molecular weight of 614.81 g/mol. Its IUPAC name is 3-[[4-[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]butyl-propylamino]methyl]-5-(1,3-oxazol-2-yl)benzamide.
| Compound Name | 3-[[4-[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]butyl-propylamino]methyl]-5-(1,3-oxazol-2-yl)benzamide |
|---|---|
| PubChem CID | 142195250 |
| Molecular Formula | C37H47FN4O3 |
| Molecular Weight | 614.81 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | 3-[[4-[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]butyl-propylamino]methyl]-5-(1,3-oxazol-2-yl)benzamide |
| SMILES | CCCN(CCCCOc1cc(F)cc(CCCCNCc2cccc(CC)c2)c1)Cc1cc(C(N)=O)cc(-c2ncco2)c1 |
| InChI | InChI=1S/C37H47FN4O3/c1-3-15-42(27-31-20-32(36(39)43)24-33(21-31)37-41-14-18-45-37)16-7-8-17-44-35-23-29(22-34(38)25-35)10-5-6-13-40-26-30-12-9-11-28(4-2)19-30/h9,11-12,14,18-25,40H,3-8,10,13,15-17,26-27H2,1-2H3,(H2,39,43) |
| InChIKey | COHIQKKHMHIMFJ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.81 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|