C29H40FN3O4 — CID 142195277
N'-[(E)-4-[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]-3-(methoxymethyl)but-3-enyl]butanediamide (PubChem CID 142195277) has the molecular formula C29H40FN3O4 and a molecular weight of 513.65 g/mol. Its IUPAC name is N'-[(E)-4-[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]-3-(methoxymethyl)but-3-enyl]butanediamide.
| Compound Name | N'-[(E)-4-[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]-3-(methoxymethyl)but-3-enyl]butanediamide |
|---|---|
| PubChem CID | 142195277 |
| Molecular Formula | C29H40FN3O4 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | N'-[(E)-4-[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]-3-(methoxymethyl)but-3-enyl]butanediamide |
| SMILES | CCc1cccc(CNCCCCc2cc(F)cc(O/C=C(\CCNC(=O)CCC(N)=O)COC)c2)c1 |
| InChI | InChI=1S/C29H40FN3O4/c1-3-22-8-6-9-24(15-22)19-32-13-5-4-7-23-16-26(30)18-27(17-23)37-21-25(20-36-2)12-14-33-29(35)11-10-28(31)34/h6,8-9,15-18,21,32H,3-5,7,10-14,19-20H2,1-2H3,(H2,31,34)(H,33,35)/b25-21+ |
| InChIKey | YNDPUFGXOVZNJT-NJNXFGOHSA-N |
| XLogP | 4.18 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|