C32H52FN3O3 — CID 142195482
ethane;5-[3-[(2S)-4-[(3-ethylphenyl)methylamino]-2-(methylamino)butyl]-5-fluorophenoxy]-N-(2-oxoethyl)pentanamide;propane (PubChem CID 142195482) has the molecular formula C32H52FN3O3 and a molecular weight of 545.78 g/mol. Its IUPAC name is ethane;5-[3-[(2S)-4-[(3-ethylphenyl)methylamino]-2-(methylamino)butyl]-5-fluorophenoxy]-N-(2-oxoethyl)pentanamide;propane.
| Compound Name | ethane;5-[3-[(2S)-4-[(3-ethylphenyl)methylamino]-2-(methylamino)butyl]-5-fluorophenoxy]-N-(2-oxoethyl)pentanamide;propane |
|---|---|
| PubChem CID | 142195482 |
| Molecular Formula | C32H52FN3O3 |
| Molecular Weight | 545.78 g/mol |
| Exact Mass | 545.40 |
| IUPAC Name | ethane;5-[3-[(2S)-4-[(3-ethylphenyl)methylamino]-2-(methylamino)butyl]-5-fluorophenoxy]-N-(2-oxoethyl)pentanamide;propane |
| SMILES | CC.CCC.CCc1cccc(CNCC[C@H](Cc2cc(F)cc(OCCCCC(=O)NCC=O)c2)NC)c1 |
| InChI | InChI=1S/C27H38FN3O3.C3H8.C2H6/c1-3-21-7-6-8-22(15-21)20-30-11-10-25(29-2)17-23-16-24(28)19-26(18-23)34-14-5-4-9-27(33)31-12-13-32;1-3-2;1-2/h6-8,13,15-16,18-19,25,29-30H,3-5,9-12,14,17,20H2,1-2H3,(H,31,33);3H2,1-2H3;1-2H3/t25-;;/m1../s1 |
| InChIKey | DQGBPDILKCZPGZ-KHZPMNTOSA-N |
| XLogP | 6.01 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.78 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|