C26H33F4N3O3 — CID 142195606
5-(3-fluoro-5-methylphenoxy)-N-[2-oxo-3-[3-[[3-(trifluoromethyl)phenyl]methylamino]propylamino]propyl]pentanamide (PubChem CID 142195606) has the molecular formula C26H33F4N3O3 and a molecular weight of 511.56 g/mol. Its IUPAC name is 5-(3-fluoro-5-methylphenoxy)-N-[2-oxo-3-[3-[[3-(trifluoromethyl)phenyl]methylamino]propylamino]propyl]pentanamide.
| Compound Name | 5-(3-fluoro-5-methylphenoxy)-N-[2-oxo-3-[3-[[3-(trifluoromethyl)phenyl]methylamino]propylamino]propyl]pentanamide |
|---|---|
| PubChem CID | 142195606 |
| Molecular Formula | C26H33F4N3O3 |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | 5-(3-fluoro-5-methylphenoxy)-N-[2-oxo-3-[3-[[3-(trifluoromethyl)phenyl]methylamino]propylamino]propyl]pentanamide |
| SMILES | Cc1cc(F)cc(OCCCCC(=O)NCC(=O)CNCCCNCc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C26H33F4N3O3/c1-19-12-22(27)15-24(13-19)36-11-3-2-8-25(35)33-18-23(34)17-32-10-5-9-31-16-20-6-4-7-21(14-20)26(28,29)30/h4,6-7,12-15,31-32H,2-3,5,8-11,16-18H2,1H3,(H,33,35) |
| InChIKey | FZPFSZDKLFHANV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|