C19H20F3NO3 — CID 151846950
2-[5-[3-[[3-(trifluoromethyl)phenyl]methylamino]propoxy]cyclohexa-2,4-dien-1-ylidene]acetic acid (PubChem CID 151846950) has the molecular formula C19H20F3NO3 and a molecular weight of 367.37 g/mol. Its IUPAC name is 2-[5-[3-[[3-(trifluoromethyl)phenyl]methylamino]propoxy]cyclohexa-2,4-dien-1-ylidene]acetic acid.
| Compound Name | 2-[5-[3-[[3-(trifluoromethyl)phenyl]methylamino]propoxy]cyclohexa-2,4-dien-1-ylidene]acetic acid |
|---|---|
| PubChem CID | 151846950 |
| Molecular Formula | C19H20F3NO3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-[5-[3-[[3-(trifluoromethyl)phenyl]methylamino]propoxy]cyclohexa-2,4-dien-1-ylidene]acetic acid |
| SMILES | O=C(O)C=C1C=CC=C(OCCCNCc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C19H20F3NO3/c20-19(21,22)16-6-1-5-15(10-16)13-23-8-3-9-26-17-7-2-4-14(11-17)12-18(24)25/h1-2,4-7,10,12,23H,3,8-9,11,13H2,(H,24,25) |
| InChIKey | SHVWITQBINZOHG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|