C34H52FN3O3 — CID 142195316
N'-[3-[[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]methyl]hexyl]-N'-propylpentanediamide (PubChem CID 142195316) has the molecular formula C34H52FN3O3 and a molecular weight of 569.81 g/mol. Its IUPAC name is N'-[3-[[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]methyl]hexyl]-N'-propylpentanediamide.
| Compound Name | N'-[3-[[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]methyl]hexyl]-N'-propylpentanediamide |
|---|---|
| PubChem CID | 142195316 |
| Molecular Formula | C34H52FN3O3 |
| Molecular Weight | 569.81 g/mol |
| Exact Mass | 569.40 |
| IUPAC Name | N'-[3-[[3-[4-[(3-ethylphenyl)methylamino]butyl]-5-fluorophenoxy]methyl]hexyl]-N'-propylpentanediamide |
| SMILES | CCCC(CCN(CCC)C(=O)CCCC(N)=O)COc1cc(F)cc(CCCCNCc2cccc(CC)c2)c1 |
| InChI | InChI=1S/C34H52FN3O3/c1-4-11-28(17-20-38(19-5-2)34(40)16-10-15-33(36)39)26-41-32-23-29(22-31(35)24-32)12-7-8-18-37-25-30-14-9-13-27(6-3)21-30/h9,13-14,21-24,28,37H,4-8,10-12,15-20,25-26H2,1-3H3,(H2,36,39) |
| InChIKey | PXWFXMKKSKBIFZ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.81 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|