C24H35N3O2 — CID 142242677
N-[3-[(3-ethylphenyl)methylamino]propyl]-3-[[2-hydroxyethyl(methyl)amino]methyl]-5-methylbenzamide (PubChem CID 142242677) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is N-[3-[(3-ethylphenyl)methylamino]propyl]-3-[[2-hydroxyethyl(methyl)amino]methyl]-5-methylbenzamide.
| Compound Name | N-[3-[(3-ethylphenyl)methylamino]propyl]-3-[[2-hydroxyethyl(methyl)amino]methyl]-5-methylbenzamide |
|---|---|
| PubChem CID | 142242677 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | N-[3-[(3-ethylphenyl)methylamino]propyl]-3-[[2-hydroxyethyl(methyl)amino]methyl]-5-methylbenzamide |
| SMILES | CCc1cccc(CNCCCNC(=O)c2cc(C)cc(CN(C)CCO)c2)c1 |
| InChI | InChI=1S/C24H35N3O2/c1-4-20-7-5-8-21(15-20)17-25-9-6-10-26-24(29)23-14-19(2)13-22(16-23)18-27(3)11-12-28/h5,7-8,13-16,25,28H,4,6,9-12,17-18H2,1-3H3,(H,26,29) |
| InChIKey | MTFFZEUJXXQYEQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|