C29H37ClN4O3 — CID 142243427
2-butoxy-N-[1-[(3R)-6-chloro-3-(methylaminomethyl)-3,4-dihydro-2H-quinolin-1-yl]-3-(1H-indol-3-yl)-1-oxobutan-2-yl]acetamide (PubChem CID 142243427) has the molecular formula C29H37ClN4O3 and a molecular weight of 525.09 g/mol. Its IUPAC name is 2-butoxy-N-[1-[(3R)-6-chloro-3-(methylaminomethyl)-3,4-dihydro-2H-quinolin-1-yl]-3-(1H-indol-3-yl)-1-oxobutan-2-yl]acetamide.
| Compound Name | 2-butoxy-N-[1-[(3R)-6-chloro-3-(methylaminomethyl)-3,4-dihydro-2H-quinolin-1-yl]-3-(1H-indol-3-yl)-1-oxobutan-2-yl]acetamide |
|---|---|
| PubChem CID | 142243427 |
| Molecular Formula | C29H37ClN4O3 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 2-butoxy-N-[1-[(3R)-6-chloro-3-(methylaminomethyl)-3,4-dihydro-2H-quinolin-1-yl]-3-(1H-indol-3-yl)-1-oxobutan-2-yl]acetamide |
| SMILES | CCCCOCC(=O)NC(C(=O)N1C[C@@H](CNC)Cc2cc(Cl)ccc21)C(C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H37ClN4O3/c1-4-5-12-37-18-27(35)33-28(19(2)24-16-32-25-9-7-6-8-23(24)25)29(36)34-17-20(15-31-3)13-21-14-22(30)10-11-26(21)34/h6-11,14,16,19-20,28,31-32H,4-5,12-13,15,17-18H2,1-3H3,(H,33,35)/t19?,20-,28?/m1/s1 |
| InChIKey | KGNVGPKEMDVVFX-VDIKJOOYSA-N |
| XLogP | 4.65 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|