C31H37ClN4O — CID 142243444
1-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-3-(1H-indol-3-yl)-2-(3-phenylpropylamino)butan-1-one;methanamine (PubChem CID 142243444) has the molecular formula C31H37ClN4O and a molecular weight of 517.12 g/mol. Its IUPAC name is 1-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-3-(1H-indol-3-yl)-2-(3-phenylpropylamino)butan-1-one;methanamine.
| Compound Name | 1-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-3-(1H-indol-3-yl)-2-(3-phenylpropylamino)butan-1-one;methanamine |
|---|---|
| PubChem CID | 142243444 |
| Molecular Formula | C31H37ClN4O |
| Molecular Weight | 517.12 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 1-(6-chloro-3,4-dihydro-2H-quinolin-1-yl)-3-(1H-indol-3-yl)-2-(3-phenylpropylamino)butan-1-one;methanamine |
| SMILES | CC(c1c[nH]c2ccccc12)C(NCCCc1ccccc1)C(=O)N1CCCc2cc(Cl)ccc21.CN |
| InChI | InChI=1S/C30H32ClN3O.CH5N/c1-21(26-20-33-27-14-6-5-13-25(26)27)29(32-17-7-11-22-9-3-2-4-10-22)30(35)34-18-8-12-23-19-24(31)15-16-28(23)34;1-2/h2-6,9-10,13-16,19-21,29,32-33H,7-8,11-12,17-18H2,1H3;2H2,1H3 |
| InChIKey | XJROGKGXRCHNLY-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.12 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|