C27H22N2O6S — CID 142244695
2-[1-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]sulfonyl-3H-indol-2-ylidene]acetic acid (PubChem CID 142244695) has the molecular formula C27H22N2O6S and a molecular weight of 502.55 g/mol. Its IUPAC name is 2-[1-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]sulfonyl-3H-indol-2-ylidene]acetic acid.
| Compound Name | 2-[1-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]sulfonyl-3H-indol-2-ylidene]acetic acid |
|---|---|
| PubChem CID | 142244695 |
| Molecular Formula | C27H22N2O6S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 2-[1-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]sulfonyl-3H-indol-2-ylidene]acetic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccc(S(=O)(=O)N2C(=CC(=O)O)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C27H22N2O6S/c1-18-24(28-27(35-18)19-7-3-2-4-8-19)17-34-22-11-13-23(14-12-22)36(32,33)29-21(16-26(30)31)15-20-9-5-6-10-25(20)29/h2-14,16H,15,17H2,1H3,(H,30,31) |
| InChIKey | ORACJBULDQYRFU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|