C22H36N2O5 — CID 142245015
ethane;2-[4-[4-(5-oxo-4-propyl-1,3,4-oxadiazol-2-yl)butyl]phenoxy]propanoic acid (PubChem CID 142245015) has the molecular formula C22H36N2O5 and a molecular weight of 408.54 g/mol. Its IUPAC name is ethane;2-[4-[4-(5-oxo-4-propyl-1,3,4-oxadiazol-2-yl)butyl]phenoxy]propanoic acid.
| Compound Name | ethane;2-[4-[4-(5-oxo-4-propyl-1,3,4-oxadiazol-2-yl)butyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 142245015 |
| Molecular Formula | C22H36N2O5 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | ethane;2-[4-[4-(5-oxo-4-propyl-1,3,4-oxadiazol-2-yl)butyl]phenoxy]propanoic acid |
| SMILES | CC.CC.CCCn1nc(CCCCc2ccc(OC(C)C(=O)O)cc2)oc1=O |
| InChI | InChI=1S/C18H24N2O5.2C2H6/c1-3-12-20-18(23)25-16(19-20)7-5-4-6-14-8-10-15(11-9-14)24-13(2)17(21)22;2*1-2/h8-11,13H,3-7,12H2,1-2H3,(H,21,22);2*1-2H3 |
| InChIKey | PWBWRYCSRDZEOI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|