C19H24N2O4S — CID 142245024
2-[4-[3-[4-[(E)-2-methylbut-2-enyl]-5-sulfanylidene-1,3,4-oxadiazol-2-yl]propyl]phenoxy]propanoic acid (PubChem CID 142245024) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[4-[3-[4-[(E)-2-methylbut-2-enyl]-5-sulfanylidene-1,3,4-oxadiazol-2-yl]propyl]phenoxy]propanoic acid.
| Compound Name | 2-[4-[3-[4-[(E)-2-methylbut-2-enyl]-5-sulfanylidene-1,3,4-oxadiazol-2-yl]propyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 142245024 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[4-[3-[4-[(E)-2-methylbut-2-enyl]-5-sulfanylidene-1,3,4-oxadiazol-2-yl]propyl]phenoxy]propanoic acid |
| SMILES | C/C=C(\C)Cn1nc(CCCc2ccc(OC(C)C(=O)O)cc2)oc1=S |
| InChI | InChI=1S/C19H24N2O4S/c1-4-13(2)12-21-19(26)25-17(20-21)7-5-6-15-8-10-16(11-9-15)24-14(3)18(22)23/h4,8-11,14H,5-7,12H2,1-3H3,(H,22,23)/b13-4+ |
| InChIKey | KDVVQJHJLGXJNM-YIXHJXPBSA-N |
| XLogP | 4.20 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|