(Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride

C8H12ClN — CID 142245103

IUPAC(Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride
SMILESC=C/N=C(Cl)/C(=C\C)CC
InChIInChI=1S/C8H12ClN/c1-4-7(5-2)8(9)10-6-3/h4,6H,3,5H2,1-2H3/b7-4-,10-8-
InChIKeyYROPAVFPELIECD-NIQHGUSQSA-N
MW157.64 g/mol
LogP3.12
Rot. Bonds3

About (Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride

(Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride (PubChem CID 142245103) has the molecular formula C8H12ClN and a molecular weight of 157.64 g/mol. Its IUPAC name is (Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride.

Molecular Properties

Compound Name(Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride
PubChem CID142245103
Molecular FormulaC8H12ClN
Molecular Weight157.64 g/mol
Exact Mass157.07
IUPAC Name(Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride
SMILESC=C/N=C(Cl)/C(=C\C)CC
InChIInChI=1S/C8H12ClN/c1-4-7(5-2)8(9)10-6-3/h4,6H,3,5H2,1-2H3/b7-4-,10-8-
InChIKeyYROPAVFPELIECD-NIQHGUSQSA-N
XLogP3.12
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.64
LogP ≤ 53.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze (Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride?
The IUPAC name of (Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride (CID 142245103) is (Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride.
What is the SMILES notation for (Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride?
The canonical SMILES for (Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride is C=C/N=C(Cl)/C(=C\C)CC.
What is the InChIKey of (Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride?
The InChIKey is YROPAVFPELIECD-NIQHGUSQSA-N. The full InChI is InChI=1S/C8H12ClN/c1-4-7(5-2)8(9)10-6-3/h4,6H,3,5H2,1-2H3/b7-4-,10-8-.
What are the key properties of (Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride?
(Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride has a molecular weight of 157.64 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-ethenyl-2-ethylbut-2-enimidoyl chloride is sourced from PubChem (CID 142245103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).