C26H35N3O2S — CID 142246139
acetylene;4-[(4-methylphenyl)methyl]piperidine;N-(2-nitrophenyl)sulfanylcyclopentanamine (PubChem CID 142246139) has the molecular formula C26H35N3O2S and a molecular weight of 453.65 g/mol. Its IUPAC name is acetylene;4-[(4-methylphenyl)methyl]piperidine;N-(2-nitrophenyl)sulfanylcyclopentanamine.
| Compound Name | acetylene;4-[(4-methylphenyl)methyl]piperidine;N-(2-nitrophenyl)sulfanylcyclopentanamine |
|---|---|
| PubChem CID | 142246139 |
| Molecular Formula | C26H35N3O2S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | acetylene;4-[(4-methylphenyl)methyl]piperidine;N-(2-nitrophenyl)sulfanylcyclopentanamine |
| SMILES | C#C.Cc1ccc(CC2CCNCC2)cc1.O=[N+]([O-])c1ccccc1SNC1CCCC1 |
| InChI | InChI=1S/C13H19N.C11H14N2O2S.C2H2/c1-11-2-4-12(5-3-11)10-13-6-8-14-9-7-13;14-13(15)10-7-3-4-8-11(10)16-12-9-5-1-2-6-9;1-2/h2-5,13-14H,6-10H2,1H3;3-4,7-9,12H,1-2,5-6H2;1-2H |
| InChIKey | OURLTBZHFZOSKL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|