C12H15NO2 — CID 142247032
(1Z)-1-[3-methoxy-4-(methylamino)phenyl]buta-1,3-dien-1-ol (PubChem CID 142247032) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (1Z)-1-[3-methoxy-4-(methylamino)phenyl]buta-1,3-dien-1-ol.
| Compound Name | (1Z)-1-[3-methoxy-4-(methylamino)phenyl]buta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 142247032 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (1Z)-1-[3-methoxy-4-(methylamino)phenyl]buta-1,3-dien-1-ol |
| SMILES | C=C/C=C(\O)c1ccc(NC)c(OC)c1 |
| InChI | InChI=1S/C12H15NO2/c1-4-5-11(14)9-6-7-10(13-2)12(8-9)15-3/h4-8,13-14H,1H2,2-3H3/b11-5- |
| InChIKey | HTDWWOLMTUNBDX-WZUFQYTHSA-N |
| XLogP | 2.82 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|