C15H26N2O7 — CID 142248367
2-[[2-[5,6-diacetyloxyhexyl(methyl)amino]-2-oxoethyl]amino]acetic acid (PubChem CID 142248367) has the molecular formula C15H26N2O7 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[[2-[5,6-diacetyloxyhexyl(methyl)amino]-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[[2-[5,6-diacetyloxyhexyl(methyl)amino]-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 142248367 |
| Molecular Formula | C15H26N2O7 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-[[2-[5,6-diacetyloxyhexyl(methyl)amino]-2-oxoethyl]amino]acetic acid |
| SMILES | CC(=O)OCC(CCCCN(C)C(=O)CNCC(=O)O)OC(C)=O |
| InChI | InChI=1S/C15H26N2O7/c1-11(18)23-10-13(24-12(2)19)6-4-5-7-17(3)14(20)8-16-9-15(21)22/h13,16H,4-10H2,1-3H3,(H,21,22) |
| InChIKey | OXCKSBWTBJEAPV-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|