C24H35N3S — CID 142248738
1-[2-imino-1-(2,4,6-trimethylphenyl)piperidin-3-yl]-N-methyl-2-thiophen-2-ylpentan-1-amine (PubChem CID 142248738) has the molecular formula C24H35N3S and a molecular weight of 397.63 g/mol. Its IUPAC name is 1-[2-imino-1-(2,4,6-trimethylphenyl)piperidin-3-yl]-N-methyl-2-thiophen-2-ylpentan-1-amine.
| Compound Name | 1-[2-imino-1-(2,4,6-trimethylphenyl)piperidin-3-yl]-N-methyl-2-thiophen-2-ylpentan-1-amine |
|---|---|
| PubChem CID | 142248738 |
| Molecular Formula | C24H35N3S |
| Molecular Weight | 397.63 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 1-[2-imino-1-(2,4,6-trimethylphenyl)piperidin-3-yl]-N-methyl-2-thiophen-2-ylpentan-1-amine |
| SMILES | [H]/N=C1\C(C(NC)C(CCC)c2cccs2)CCCN1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H35N3S/c1-6-9-19(21-11-8-13-28-21)22(26-5)20-10-7-12-27(24(20)25)23-17(3)14-16(2)15-18(23)4/h8,11,13-15,19-20,22,25-26H,6-7,9-10,12H2,1-5H3/b25-24+ |
| InChIKey | UHSHCKDWOIQQGB-OCOZRVBESA-N |
| XLogP | 6.04 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.63 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|