About chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol
chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol (PubChem CID 142248928) has the molecular formula C13H27Cl2NO2
and a molecular weight of 300.27 g/mol. Its IUPAC name is chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol.
Molecular Properties
| Compound Name | chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol |
| PubChem CID | 142248928 |
| Molecular Formula | C13H27Cl2NO2 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol |
| SMILES | CC(Cl)CN1CCOC12CCCCC2.CCl.CO |
| InChI | InChI=1S/C11H20ClNO.CH3Cl.CH4O/c1-10(12)9-13-7-8-14-11(13)5-3-2-4-6-11;2*1-2/h10H,2-9H2,1H3;1H3;2H,1H3 |
| InChIKey | YAAODGFKBHHOPO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol?
The IUPAC name of chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol (CID 142248928) is chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol.
What is the SMILES notation for chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol?
The canonical SMILES for chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol is CC(Cl)CN1CCOC12CCCCC2.CCl.CO.
What is the InChIKey of chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol?
The InChIKey is YAAODGFKBHHOPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20ClNO.CH3Cl.CH4O/c1-10(12)9-13-7-8-14-11(13)5-3-2-4-6-11;2*1-2/h10H,2-9H2,1H3;1H3;2H,1H3.
What are the key properties of chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol?
chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol has a molecular weight of 300.27 g/mol, XLogP of 3.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;4-(2-chloropropyl)-1-oxa-4-azaspiro[4.5]decane;methanol is sourced from PubChem (CID 142248928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).