C12H20N2 — CID 142249081
1-[(Z)-[(2Z,5Z)-hepta-2,5-dienylidene]amino]-N,2-dimethylprop-2-en-1-amine (PubChem CID 142249081) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-[(Z)-[(2Z,5Z)-hepta-2,5-dienylidene]amino]-N,2-dimethylprop-2-en-1-amine.
| Compound Name | 1-[(Z)-[(2Z,5Z)-hepta-2,5-dienylidene]amino]-N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 142249081 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-[(Z)-[(2Z,5Z)-hepta-2,5-dienylidene]amino]-N,2-dimethylprop-2-en-1-amine |
| SMILES | C=C(C)C(/N=C\C=C/C/C=C\C)NC |
| InChI | InChI=1S/C12H20N2/c1-5-6-7-8-9-10-14-12(13-4)11(2)3/h5-6,8-10,12-13H,2,7H2,1,3-4H3/b6-5-,9-8-,14-10- |
| InChIKey | GSCFQSPXGMHVTG-FDLHNHOKSA-N |
| XLogP | 2.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|