C13H19N3 — CID 143011685
(Z,2E)-2-[(methylideneamino)methylidene]-N-[1-[(Z)-2-methylprop-2-enylideneamino]ethenyl]pent-3-en-1-amine (PubChem CID 143011685) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is (Z,2E)-2-[(methylideneamino)methylidene]-N-[1-[(Z)-2-methylprop-2-enylideneamino]ethenyl]pent-3-en-1-amine.
| Compound Name | (Z,2E)-2-[(methylideneamino)methylidene]-N-[1-[(Z)-2-methylprop-2-enylideneamino]ethenyl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 143011685 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (Z,2E)-2-[(methylideneamino)methylidene]-N-[1-[(Z)-2-methylprop-2-enylideneamino]ethenyl]pent-3-en-1-amine |
| SMILES | C=N/C=C(\C=C/C)CNC(=C)/N=C\C(=C)C |
| InChI | InChI=1S/C13H19N3/c1-6-7-13(9-14-5)10-16-12(4)15-8-11(2)3/h6-9,16H,2,4-5,10H2,1,3H3/b7-6-,13-9+,15-8- |
| InChIKey | MARLXSHYHWBTTD-XALATSHHSA-N |
| XLogP | 2.85 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|