C30H31NO2S — CID 142249286
4-[[4-[4-[(4-cyclohexylphenyl)methoxy]phenyl]-2,3-dihydro-1,3-thiazol-2-yl]methyl]benzaldehyde (PubChem CID 142249286) has the molecular formula C30H31NO2S and a molecular weight of 469.65 g/mol. Its IUPAC name is 4-[[4-[4-[(4-cyclohexylphenyl)methoxy]phenyl]-2,3-dihydro-1,3-thiazol-2-yl]methyl]benzaldehyde.
| Compound Name | 4-[[4-[4-[(4-cyclohexylphenyl)methoxy]phenyl]-2,3-dihydro-1,3-thiazol-2-yl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 142249286 |
| Molecular Formula | C30H31NO2S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 4-[[4-[4-[(4-cyclohexylphenyl)methoxy]phenyl]-2,3-dihydro-1,3-thiazol-2-yl]methyl]benzaldehyde |
| SMILES | O=Cc1ccc(CC2NC(c3ccc(OCc4ccc(C5CCCCC5)cc4)cc3)=CS2)cc1 |
| InChI | InChI=1S/C30H31NO2S/c32-19-23-8-6-22(7-9-23)18-30-31-29(21-34-30)27-14-16-28(17-15-27)33-20-24-10-12-26(13-11-24)25-4-2-1-3-5-25/h6-17,19,21,25,30-31H,1-5,18,20H2 |
| InChIKey | AJFAXNTZZODNRS-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|