C22H29F4N3O2 — CID 142251175
1-(2-bicyclo[3.1.0]hexanyl)-3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(4-morpholin-4-ylbutyl)urea (PubChem CID 142251175) has the molecular formula C22H29F4N3O2 and a molecular weight of 443.49 g/mol. Its IUPAC name is 1-(2-bicyclo[3.1.0]hexanyl)-3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(4-morpholin-4-ylbutyl)urea.
| Compound Name | 1-(2-bicyclo[3.1.0]hexanyl)-3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(4-morpholin-4-ylbutyl)urea |
|---|---|
| PubChem CID | 142251175 |
| Molecular Formula | C22H29F4N3O2 |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 1-(2-bicyclo[3.1.0]hexanyl)-3-[4-fluoro-3-(trifluoromethyl)phenyl]-1-(4-morpholin-4-ylbutyl)urea |
| SMILES | O=C(Nc1ccc(F)c(C(F)(F)F)c1)N(CCCCN1CCOCC1)C1CCC2CC21 |
| InChI | InChI=1S/C22H29F4N3O2/c23-19-5-4-16(14-18(19)22(24,25)26)27-21(30)29(20-6-3-15-13-17(15)20)8-2-1-7-28-9-11-31-12-10-28/h4-5,14-15,17,20H,1-3,6-13H2,(H,27,30) |
| InChIKey | MGWNHEOYXLZYRG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|