C19H20N4O4S — CID 142253948
[4-[2-[(1-methylimidazol-4-yl)sulfonylamino]ethyl]phenyl] N-phenylcarbamate (PubChem CID 142253948) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is [4-[2-[(1-methylimidazol-4-yl)sulfonylamino]ethyl]phenyl] N-phenylcarbamate.
| Compound Name | [4-[2-[(1-methylimidazol-4-yl)sulfonylamino]ethyl]phenyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 142253948 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [4-[2-[(1-methylimidazol-4-yl)sulfonylamino]ethyl]phenyl] N-phenylcarbamate |
| SMILES | Cn1cnc(S(=O)(=O)NCCc2ccc(OC(=O)Nc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C19H20N4O4S/c1-23-13-18(20-14-23)28(25,26)21-12-11-15-7-9-17(10-8-15)27-19(24)22-16-5-3-2-4-6-16/h2-10,13-14,21H,11-12H2,1H3,(H,22,24) |
| InChIKey | XLZGBOPEKNMNOO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |