C17H20O3 — CID 142254377
(3E)-6-[(3Z,5E)-hepta-1,3,5-trien-2-yl]-3-[(E)-3-methoxyprop-2-enylidene]-2-methylideneoxan-4-one (PubChem CID 142254377) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is (3E)-6-[(3Z,5E)-hepta-1,3,5-trien-2-yl]-3-[(E)-3-methoxyprop-2-enylidene]-2-methylideneoxan-4-one.
| Compound Name | (3E)-6-[(3Z,5E)-hepta-1,3,5-trien-2-yl]-3-[(E)-3-methoxyprop-2-enylidene]-2-methylideneoxan-4-one |
|---|---|
| PubChem CID | 142254377 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (3E)-6-[(3Z,5E)-hepta-1,3,5-trien-2-yl]-3-[(E)-3-methoxyprop-2-enylidene]-2-methylideneoxan-4-one |
| SMILES | C=C1OC(C(=C)/C=C\C=C\C)CC(=O)/C1=C/C=C/OC |
| InChI | InChI=1S/C17H20O3/c1-5-6-7-9-13(2)17-12-16(18)15(14(3)20-17)10-8-11-19-4/h5-11,17H,2-3,12H2,1,4H3/b6-5+,9-7-,11-8+,15-10+ |
| InChIKey | ZOIXVIHNMHGUTG-ZBAWVSMQSA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|