C16H20O3 — CID 69129185
2-(4-methoxycyclohexa-1,5-dien-1-yl)-2,3,5,6,7,8-hexahydrochromen-4-one (PubChem CID 69129185) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-(4-methoxycyclohexa-1,5-dien-1-yl)-2,3,5,6,7,8-hexahydrochromen-4-one.
| Compound Name | 2-(4-methoxycyclohexa-1,5-dien-1-yl)-2,3,5,6,7,8-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 69129185 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-(4-methoxycyclohexa-1,5-dien-1-yl)-2,3,5,6,7,8-hexahydrochromen-4-one |
| SMILES | COC1C=CC(C2CC(=O)C3=C(CCCC3)O2)=CC1 |
| InChI | InChI=1S/C16H20O3/c1-18-12-8-6-11(7-9-12)16-10-14(17)13-4-2-3-5-15(13)19-16/h6-8,12,16H,2-5,9-10H2,1H3 |
| InChIKey | IOJRCVBWCMBRES-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |