C15H18O2 — CID 69302703
2-cyclohexa-1,5-dien-1-yl-2,3,5,6,7,8-hexahydrochromen-4-one (PubChem CID 69302703) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-2,3,5,6,7,8-hexahydrochromen-4-one.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-2,3,5,6,7,8-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 69302703 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-2,3,5,6,7,8-hexahydrochromen-4-one |
| SMILES | O=C1CC(C2=CCCC=C2)OC2=C1CCCC2 |
| InChI | InChI=1S/C15H18O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h2,6-7,15H,1,3-5,8-10H2 |
| InChIKey | BGEUTLSWIRAEBF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |