About 1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one
1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one (PubChem CID 142254523) has the molecular formula C26H29Cl2N3O2
and a molecular weight of 486.44 g/mol. Its IUPAC name is 1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one.
Molecular Properties
| Compound Name | 1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one |
| PubChem CID | 142254523 |
| Molecular Formula | C26H29Cl2N3O2 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one |
| SMILES | Clc1ccccc1Cl.O=C1CCC(CCNCCOc2ccccc2)CN1c1ccccn1 |
| InChI | InChI=1S/C20H25N3O2.C6H4Cl2/c24-20-10-9-17(16-23(20)19-8-4-5-12-22-19)11-13-21-14-15-25-18-6-2-1-3-7-18;7-5-3-1-2-4-6(5)8/h1-8,12,17,21H,9-11,13-16H2;1-4H |
| InChIKey | YNWDZAJROKSHCI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one?
The IUPAC name of 1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one (CID 142254523) is 1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one.
What is the SMILES notation for 1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one?
The canonical SMILES for 1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one is Clc1ccccc1Cl.O=C1CCC(CCNCCOc2ccccc2)CN1c1ccccn1.
What is the InChIKey of 1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one?
The InChIKey is YNWDZAJROKSHCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O2.C6H4Cl2/c24-20-10-9-17(16-23(20)19-8-4-5-12-22-19)11-13-21-14-15-25-18-6-2-1-3-7-18;7-5-3-1-2-4-6(5)8/h1-8,12,17,21H,9-11,13-16H2;1-4H.
What are the key properties of 1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one?
1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one has a molecular weight of 486.44 g/mol, XLogP of 5.88, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichlorobenzene;5-[2-(2-phenoxyethylamino)ethyl]-1-pyridin-2-ylpiperidin-2-one is sourced from PubChem (CID 142254523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).