C24H32FN5O2 — CID 26340358
(5R)-5-[2-[2-(4-fluorophenoxy)ethylamino]ethyl]-1-[[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]methyl]pyrrolidin-2-one (PubChem CID 26340358) has the molecular formula C24H32FN5O2 and a molecular weight of 441.55 g/mol. Its IUPAC name is (5R)-5-[2-[2-(4-fluorophenoxy)ethylamino]ethyl]-1-[[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]methyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[2-[2-(4-fluorophenoxy)ethylamino]ethyl]-1-[[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 26340358 |
| Molecular Formula | C24H32FN5O2 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | (5R)-5-[2-[2-(4-fluorophenoxy)ethylamino]ethyl]-1-[[(3S)-1-pyrimidin-2-ylpiperidin-3-yl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](CCNCCOc2ccc(F)cc2)N1C[C@H]1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C24H32FN5O2/c25-20-4-7-22(8-5-20)32-16-14-26-13-10-21-6-9-23(31)30(21)18-19-3-1-15-29(17-19)24-27-11-2-12-28-24/h2,4-5,7-8,11-12,19,21,26H,1,3,6,9-10,13-18H2/t19-,21+/m0/s1 |
| InChIKey | PLSCSHGKHPIHCL-PZJWPPBQSA-N |
| XLogP | 2.88 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|