C25H33N5O3 — CID 26337158
methyl 4-[[2-[(2S)-5-oxo-1-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methyl]pyrrolidin-2-yl]ethylamino]methyl]benzoate (PubChem CID 26337158) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is methyl 4-[[2-[(2S)-5-oxo-1-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methyl]pyrrolidin-2-yl]ethylamino]methyl]benzoate.
| Compound Name | methyl 4-[[2-[(2S)-5-oxo-1-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methyl]pyrrolidin-2-yl]ethylamino]methyl]benzoate |
|---|---|
| PubChem CID | 26337158 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | methyl 4-[[2-[(2S)-5-oxo-1-[[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]methyl]pyrrolidin-2-yl]ethylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNCC[C@@H]2CCC(=O)N2C[C@@H]2CCCN(c3ncccn3)C2)cc1 |
| InChI | InChI=1S/C25H33N5O3/c1-33-24(32)21-7-5-19(6-8-21)16-26-14-11-22-9-10-23(31)30(22)18-20-4-2-15-29(17-20)25-27-12-3-13-28-25/h3,5-8,12-13,20,22,26H,2,4,9-11,14-18H2,1H3/t20-,22+/m1/s1 |
| InChIKey | PAQHPFUBBMWNOF-IRLDBZIGSA-N |
| XLogP | 2.65 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|