C23H22N4OPS+ — CID 142255014
[3-[(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamothioylamino]phenyl]phosphanium (PubChem CID 142255014) has the molecular formula C23H22N4OPS+ and a molecular weight of 433.50 g/mol. Its IUPAC name is [3-[(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamothioylamino]phenyl]phosphanium.
| Compound Name | [3-[(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamothioylamino]phenyl]phosphanium |
|---|---|
| PubChem CID | 142255014 |
| Molecular Formula | C23H22N4OPS+ |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | [3-[(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)carbamothioylamino]phenyl]phosphanium |
| SMILES | CN1C(=O)C(NC(=S)Nc2cccc([PH3+])c2)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H21N4OPS/c1-27-19-13-6-5-12-18(19)20(15-8-3-2-4-9-15)25-21(22(27)28)26-23(30)24-16-10-7-11-17(29)14-16/h2-14,21H,29H2,1H3,(H2,24,26,30)/p+1 |
| InChIKey | TVTBRBBNKGIOHM-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|