C24H22N4O2S — CID 59714125
1-(2-methoxyphenyl)-3-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea (PubChem CID 59714125) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea.
| Compound Name | 1-(2-methoxyphenyl)-3-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea |
|---|---|
| PubChem CID | 59714125 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-(1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl)thiourea |
| SMILES | COc1ccccc1NC(=S)NC1N=C(c2ccccc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C24H22N4O2S/c1-28-19-14-8-6-12-17(19)21(16-10-4-3-5-11-16)26-22(23(28)29)27-24(31)25-18-13-7-9-15-20(18)30-2/h3-15,22H,1-2H3,(H2,25,27,31) |
| InChIKey | LOAUFOHQHWGYNA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|