C21H24ClN3O3 — CID 142255036
ethyl 2-[1-[(Z)-[[5-chloro-2-[formyl(methyl)amino]phenyl]-phenylmethylidene]amino]ethylamino]acetate (PubChem CID 142255036) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is ethyl 2-[1-[(Z)-[[5-chloro-2-[formyl(methyl)amino]phenyl]-phenylmethylidene]amino]ethylamino]acetate.
| Compound Name | ethyl 2-[1-[(Z)-[[5-chloro-2-[formyl(methyl)amino]phenyl]-phenylmethylidene]amino]ethylamino]acetate |
|---|---|
| PubChem CID | 142255036 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | ethyl 2-[1-[(Z)-[[5-chloro-2-[formyl(methyl)amino]phenyl]-phenylmethylidene]amino]ethylamino]acetate |
| SMILES | CCOC(=O)CNC(C)/N=C(/c1ccccc1)c1cc(Cl)ccc1N(C)C=O |
| InChI | InChI=1S/C21H24ClN3O3/c1-4-28-20(27)13-23-15(2)24-21(16-8-6-5-7-9-16)18-12-17(22)10-11-19(18)25(3)14-26/h5-12,14-15,23H,4,13H2,1-3H3/b24-21- |
| InChIKey | BVOITGXLSIZRRA-FLFQWRMESA-N |
| XLogP | 3.27 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|