C16H16N4O — CID 142255110
3-amino-1,7-dimethyl-5-pyridin-3-yl-3H-1,4-benzodiazepin-2-one (PubChem CID 142255110) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-amino-1,7-dimethyl-5-pyridin-3-yl-3H-1,4-benzodiazepin-2-one.
| Compound Name | 3-amino-1,7-dimethyl-5-pyridin-3-yl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 142255110 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 3-amino-1,7-dimethyl-5-pyridin-3-yl-3H-1,4-benzodiazepin-2-one |
| SMILES | Cc1ccc2c(c1)C(c1cccnc1)=NC(N)C(=O)N2C |
| InChI | InChI=1S/C16H16N4O/c1-10-5-6-13-12(8-10)14(11-4-3-7-18-9-11)19-15(17)16(21)20(13)2/h3-9,15H,17H2,1-2H3 |
| InChIKey | XCYQEFTXJFHVJW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |