C24H31FN4O3S — CID 142257464
5-fluoro-2-[[5-[5-hydroxy-5-(2-methylpropylamino)pentyl]-4-(3-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenol (PubChem CID 142257464) has the molecular formula C24H31FN4O3S and a molecular weight of 474.60 g/mol. Its IUPAC name is 5-fluoro-2-[[5-[5-hydroxy-5-(2-methylpropylamino)pentyl]-4-(3-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenol.
| Compound Name | 5-fluoro-2-[[5-[5-hydroxy-5-(2-methylpropylamino)pentyl]-4-(3-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenol |
|---|---|
| PubChem CID | 142257464 |
| Molecular Formula | C24H31FN4O3S |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 5-fluoro-2-[[5-[5-hydroxy-5-(2-methylpropylamino)pentyl]-4-(3-hydroxyphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]phenol |
| SMILES | CC(C)CNC(O)CCCCc1nnc(SCc2ccc(F)cc2O)n1-c1cccc(O)c1 |
| InChI | InChI=1S/C24H31FN4O3S/c1-16(2)14-26-23(32)9-4-3-8-22-27-28-24(29(22)19-6-5-7-20(30)13-19)33-15-17-10-11-18(25)12-21(17)31/h5-7,10-13,16,23,26,30-32H,3-4,8-9,14-15H2,1-2H3 |
| InChIKey | LNMIVSFFDUNOJH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|