C24H34O5 — CID 142258750
tert-butyl 2-[(3-phenylmethoxyphenyl)methyl]cyclopropane-1-carboxylate;methanol (PubChem CID 142258750) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is tert-butyl 2-[(3-phenylmethoxyphenyl)methyl]cyclopropane-1-carboxylate;methanol.
| Compound Name | tert-butyl 2-[(3-phenylmethoxyphenyl)methyl]cyclopropane-1-carboxylate;methanol |
|---|---|
| PubChem CID | 142258750 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | tert-butyl 2-[(3-phenylmethoxyphenyl)methyl]cyclopropane-1-carboxylate;methanol |
| SMILES | CC(C)(C)OC(=O)C1CC1Cc1cccc(OCc2ccccc2)c1.CO.CO |
| InChI | InChI=1S/C22H26O3.2CH4O/c1-22(2,3)25-21(23)20-14-18(20)12-17-10-7-11-19(13-17)24-15-16-8-5-4-6-9-16;2*1-2/h4-11,13,18,20H,12,14-15H2,1-3H3;2*2H,1H3 |
| InChIKey | HANQTPUBCFRHGS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |