C22H27N3O9S2 — CID 142260133
N-methoxy-2-[[4-(4-methylsulfonylphenoxy)phenyl]sulfonyl-(2-morpholin-4-yl-2-oxoethyl)amino]acetamide (PubChem CID 142260133) has the molecular formula C22H27N3O9S2 and a molecular weight of 541.60 g/mol. Its IUPAC name is N-methoxy-2-[[4-(4-methylsulfonylphenoxy)phenyl]sulfonyl-(2-morpholin-4-yl-2-oxoethyl)amino]acetamide.
| Compound Name | N-methoxy-2-[[4-(4-methylsulfonylphenoxy)phenyl]sulfonyl-(2-morpholin-4-yl-2-oxoethyl)amino]acetamide |
|---|---|
| PubChem CID | 142260133 |
| Molecular Formula | C22H27N3O9S2 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | N-methoxy-2-[[4-(4-methylsulfonylphenoxy)phenyl]sulfonyl-(2-morpholin-4-yl-2-oxoethyl)amino]acetamide |
| SMILES | CONC(=O)CN(CC(=O)N1CCOCC1)S(=O)(=O)c1ccc(Oc2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H27N3O9S2/c1-32-23-21(26)15-25(16-22(27)24-11-13-33-14-12-24)36(30,31)20-9-5-18(6-10-20)34-17-3-7-19(8-4-17)35(2,28)29/h3-10H,11-16H2,1-2H3,(H,23,26) |
| InChIKey | ZRXWMOASCSDQPO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|