C23H27FN4O7S — CID 144574208
N-ethenyl-N-[2-[[4-(4-fluorophenoxy)phenyl]sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]morpholine-4-carboxamide (PubChem CID 144574208) has the molecular formula C23H27FN4O7S and a molecular weight of 522.56 g/mol. Its IUPAC name is N-ethenyl-N-[2-[[4-(4-fluorophenoxy)phenyl]sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]morpholine-4-carboxamide.
| Compound Name | N-ethenyl-N-[2-[[4-(4-fluorophenoxy)phenyl]sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 144574208 |
| Molecular Formula | C23H27FN4O7S |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | N-ethenyl-N-[2-[[4-(4-fluorophenoxy)phenyl]sulfonyl-[2-(hydroxyamino)-2-oxoethyl]amino]ethyl]morpholine-4-carboxamide |
| SMILES | C=CN(CCN(CC(=O)NO)S(=O)(=O)c1ccc(Oc2ccc(F)cc2)cc1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H27FN4O7S/c1-2-26(23(30)27-13-15-34-16-14-27)11-12-28(17-22(29)25-31)36(32,33)21-9-7-20(8-10-21)35-19-5-3-18(24)4-6-19/h2-10,31H,1,11-17H2,(H,25,29) |
| InChIKey | POUXGIYEHFCICL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|