C22H24F3N3O3 — CID 142261116
3-methyl-5-[5-[2-[2-(trifluoromethoxy)phenyl]ethylamino]pentanoyl]-1H-benzimidazol-2-one (PubChem CID 142261116) has the molecular formula C22H24F3N3O3 and a molecular weight of 435.45 g/mol. Its IUPAC name is 3-methyl-5-[5-[2-[2-(trifluoromethoxy)phenyl]ethylamino]pentanoyl]-1H-benzimidazol-2-one.
| Compound Name | 3-methyl-5-[5-[2-[2-(trifluoromethoxy)phenyl]ethylamino]pentanoyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 142261116 |
| Molecular Formula | C22H24F3N3O3 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 3-methyl-5-[5-[2-[2-(trifluoromethoxy)phenyl]ethylamino]pentanoyl]-1H-benzimidazol-2-one |
| SMILES | Cn1c(=O)[nH]c2ccc(C(=O)CCCCNCCc3ccccc3OC(F)(F)F)cc21 |
| InChI | InChI=1S/C22H24F3N3O3/c1-28-18-14-16(9-10-17(18)27-21(28)30)19(29)7-4-5-12-26-13-11-15-6-2-3-8-20(15)31-22(23,24)25/h2-3,6,8-10,14,26H,4-5,7,11-13H2,1H3,(H,27,30) |
| InChIKey | HMPFTLGPTHBJEW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|