C22H38N4O3S — CID 142262128
tert-butyl N-[2-[amino-[(E)-4-(4-aminophenyl)sulfinyloct-3-en-3-yl]amino]ethyl]-N-methylcarbamate (PubChem CID 142262128) has the molecular formula C22H38N4O3S and a molecular weight of 438.64 g/mol. Its IUPAC name is tert-butyl N-[2-[amino-[(E)-4-(4-aminophenyl)sulfinyloct-3-en-3-yl]amino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[amino-[(E)-4-(4-aminophenyl)sulfinyloct-3-en-3-yl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 142262128 |
| Molecular Formula | C22H38N4O3S |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | tert-butyl N-[2-[amino-[(E)-4-(4-aminophenyl)sulfinyloct-3-en-3-yl]amino]ethyl]-N-methylcarbamate |
| SMILES | CCCC/C(=C(/CC)N(N)CCN(C)C(=O)OC(C)(C)C)S(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C22H38N4O3S/c1-7-9-10-20(30(28)18-13-11-17(23)12-14-18)19(8-2)26(24)16-15-25(6)21(27)29-22(3,4)5/h11-14H,7-10,15-16,23-24H2,1-6H3/b20-19+ |
| InChIKey | PQYHBOUYPMTSSZ-FMQUCBEESA-N |
| XLogP | 4.23 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|