C19H22N6 — CID 142263038
3-(methylideneamino)-4-[5-(pyrrolidin-1-ylmethyl)-1H-indol-2-yl]pyridine-2,6-diamine (PubChem CID 142263038) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is 3-(methylideneamino)-4-[5-(pyrrolidin-1-ylmethyl)-1H-indol-2-yl]pyridine-2,6-diamine.
| Compound Name | 3-(methylideneamino)-4-[5-(pyrrolidin-1-ylmethyl)-1H-indol-2-yl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 142263038 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 3-(methylideneamino)-4-[5-(pyrrolidin-1-ylmethyl)-1H-indol-2-yl]pyridine-2,6-diamine |
| SMILES | C=Nc1c(-c2cc3cc(CN4CCCC4)ccc3[nH]2)cc(N)nc1N |
| InChI | InChI=1S/C19H22N6/c1-22-18-14(10-17(20)24-19(18)21)16-9-13-8-12(4-5-15(13)23-16)11-25-6-2-3-7-25/h4-5,8-10,23H,1-3,6-7,11H2,(H4,20,21,24) |
| InChIKey | QLIXNHFCTOEPDP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|