C25H30N4O2 — CID 68825189
5-[(dimethylamino)methyl]-4-hydroxy-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-1-one (PubChem CID 68825189) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 5-[(dimethylamino)methyl]-4-hydroxy-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-1-one.
| Compound Name | 5-[(dimethylamino)methyl]-4-hydroxy-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 68825189 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 5-[(dimethylamino)methyl]-4-hydroxy-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-1-one |
| SMILES | CN(C)Cc1cc(-c2cc3cc(CN4CCCCC4)ccc3[nH]2)c2c(c1O)CNC2=O |
| InChI | InChI=1S/C25H30N4O2/c1-28(2)15-18-11-19(23-20(24(18)30)13-26-25(23)31)22-12-17-10-16(6-7-21(17)27-22)14-29-8-4-3-5-9-29/h6-7,10-12,27,30H,3-5,8-9,13-15H2,1-2H3,(H,26,31) |
| InChIKey | SLITWAYEQXPSKB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|