C27H27N3O2 — CID 173114284
4-(5-hydroxypent-3-en-1-ynyl)-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-1-one (PubChem CID 173114284) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-(5-hydroxypent-3-en-1-ynyl)-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-1-one.
| Compound Name | 4-(5-hydroxypent-3-en-1-ynyl)-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 173114284 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 4-(5-hydroxypent-3-en-1-ynyl)-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2c(C#CC=CCO)ccc(-c3cc4cc(CN5CCCCC5)ccc4[nH]3)c21 |
| InChI | InChI=1S/C27H27N3O2/c31-14-6-1-3-7-20-9-10-22(26-23(20)17-28-27(26)32)25-16-21-15-19(8-11-24(21)29-25)18-30-12-4-2-5-13-30/h1,6,8-11,15-16,29,31H,2,4-5,12-14,17-18H2,(H,28,32) |
| InChIKey | VDJNOVIESIEKKS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|