C20H22ClN3O2 — CID 46215362
7-[5-[(2-hydroxyethylamino)methyl]-1H-indol-2-yl]-4-methyl-2,3-dihydroisoindol-1-one;hydrochloride (PubChem CID 46215362) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 7-[5-[(2-hydroxyethylamino)methyl]-1H-indol-2-yl]-4-methyl-2,3-dihydroisoindol-1-one;hydrochloride.
| Compound Name | 7-[5-[(2-hydroxyethylamino)methyl]-1H-indol-2-yl]-4-methyl-2,3-dihydroisoindol-1-one;hydrochloride |
|---|---|
| PubChem CID | 46215362 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 7-[5-[(2-hydroxyethylamino)methyl]-1H-indol-2-yl]-4-methyl-2,3-dihydroisoindol-1-one;hydrochloride |
| SMILES | Cc1ccc(-c2cc3cc(CNCCO)ccc3[nH]2)c2c1CNC2=O.Cl |
| InChI | InChI=1S/C20H21N3O2.ClH/c1-12-2-4-15(19-16(12)11-22-20(19)25)18-9-14-8-13(10-21-6-7-24)3-5-17(14)23-18;/h2-5,8-9,21,23-24H,6-7,10-11H2,1H3,(H,22,25);1H |
| InChIKey | MBFKQKUBNKRNEA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|